C27H18N3O4S- — CID 7011126
3-[5-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 7011126) has the molecular formula C27H18N3O4S- and a molecular weight of 480.53 g/mol. Its IUPAC name is 3-[5-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7011126 |
| Molecular Formula | C27H18N3O4S- |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-[5-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(-c2ccc(/C=C3\S/C(=N\c4ccccc4)N(Cc4cccnc4)C3=O)o2)c1 |
| InChI | InChI=1S/C27H19N3O4S/c31-25-24(15-22-11-12-23(34-22)19-7-4-8-20(14-19)26(32)33)35-27(29-21-9-2-1-3-10-21)30(25)17-18-6-5-13-28-16-18/h1-16H,17H2,(H,32,33)/p-1/b24-15-,29-27- |
| InChIKey | ZLYWEIVZLOABSE-GDXYPYGWSA-M |
| XLogP | 4.51 |
| TPSA | 98.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|