C23H22N2O7S — CID 43861183
4-[[(5Z)-5-[[2-(1-carboxypropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid (PubChem CID 43861183) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[2-(1-carboxypropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(5Z)-5-[[2-(1-carboxypropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43861183 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 4-[[(5Z)-5-[[2-(1-carboxypropoxy)phenyl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
| SMILES | CCC(Oc1ccccc1/C=C1\S/C(=N/c2ccc(C(=O)O)c(O)c2)N(CC)C1=O)C(=O)O |
| InChI | InChI=1S/C23H22N2O7S/c1-3-17(22(30)31)32-18-8-6-5-7-13(18)11-19-20(27)25(4-2)23(33-19)24-14-9-10-15(21(28)29)16(26)12-14/h5-12,17,26H,3-4H2,1-2H3,(H,28,29)(H,30,31)/b19-11-,24-23+ |
| InChIKey | ZYTHFRQMGCCBIH-FHECECNMSA-N |
| XLogP | 3.96 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|