C24H21N3O2S2 — CID 18845317
(2E,5Z)-3-ethyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18845317) has the molecular formula C24H21N3O2S2 and a molecular weight of 447.59 g/mol. Its IUPAC name is (2E,5Z)-3-ethyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-ethyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845317 |
| Molecular Formula | C24H21N3O2S2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (2E,5Z)-3-ethyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1ccccc1/C=C1\S/C(=N/c2nc(-c3ccccc3)cs2)N(CC)C1=O |
| InChI | InChI=1S/C24H21N3O2S2/c1-3-14-29-20-13-9-8-12-18(20)15-21-22(28)27(4-2)24(31-21)26-23-25-19(16-30-23)17-10-6-5-7-11-17/h3,5-13,15-16H,1,4,14H2,2H3/b21-15-,26-24+ |
| InChIKey | XRAZNEOERMRGDB-SYUAUQEVSA-N |
| XLogP | 6.00 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|