C30H25N3O2S2 — CID 18845421
(2E,5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18845421) has the molecular formula C30H25N3O2S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is (2E,5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845421 |
| Molecular Formula | C30H25N3O2S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | (2E,5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2ccccc2OCc2ccc(C)cc2)S/C1=N/c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C30H25N3O2S2/c1-3-17-33-28(34)27(37-30(33)32-29-31-25(20-36-29)23-9-5-4-6-10-23)18-24-11-7-8-12-26(24)35-19-22-15-13-21(2)14-16-22/h3-16,18,20H,1,17,19H2,2H3/b27-18-,32-30+ |
| InChIKey | DUNAEWVKTSVFLB-WNKABTNQSA-N |
| XLogP | 7.49 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|