C24H18N4O3S2 — CID 18845485
(2E,5Z)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18845485) has the molecular formula C24H18N4O3S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is (2E,5Z)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845485 |
| Molecular Formula | C24H18N4O3S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (2E,5Z)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/C=C/c2ccccc2[N+](=O)[O-])S/C1=N/c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H18N4O3S2/c1-2-15-27-22(29)21(14-8-12-18-11-6-7-13-20(18)28(30)31)33-24(27)26-23-25-19(16-32-23)17-9-4-3-5-10-17/h2-14,16H,1,15H2/b12-8+,21-14-,26-24+ |
| InChIKey | GQANDMMFIFXQRO-XDUHEITJSA-N |
| XLogP | 6.06 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|