C22H16FN3OS2 — CID 18845456
(2E,5Z)-5-[(2-fluorophenyl)methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18845456) has the molecular formula C22H16FN3OS2 and a molecular weight of 421.52 g/mol. Its IUPAC name is (2E,5Z)-5-[(2-fluorophenyl)methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2-fluorophenyl)methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845456 |
| Molecular Formula | C22H16FN3OS2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (2E,5Z)-5-[(2-fluorophenyl)methylidene]-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2ccccc2F)S/C1=N/c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H16FN3OS2/c1-2-12-26-20(27)19(13-16-10-6-7-11-17(16)23)29-22(26)25-21-24-18(14-28-21)15-8-4-3-5-9-15/h2-11,13-14H,1,12H2/b19-13-,25-22+ |
| InChIKey | LRXWONPFLJJUEF-SFLUQZEPSA-N |
| XLogP | 5.74 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|