C31H25BrN2O2S — CID 3884790
3-benzyl-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 3884790) has the molecular formula C31H25BrN2O2S and a molecular weight of 569.52 g/mol. Its IUPAC name is 3-benzyl-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3884790 |
| Molecular Formula | C31H25BrN2O2S |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 3-benzyl-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\SC(=Cc3ccccc3OCc3ccc(Br)cc3)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H25BrN2O2S/c1-22-11-17-27(18-12-22)33-31-34(20-23-7-3-2-4-8-23)30(35)29(37-31)19-25-9-5-6-10-28(25)36-21-24-13-15-26(32)16-14-24/h2-19H,20-21H2,1H3/b29-19?,33-31- |
| InChIKey | IVDQAWSOMTUTGB-AIZYIBKVSA-N |
| XLogP | 8.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|