C23H18N4O2S2 — CID 18845370
(2E,5Z)-3-ethyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18845370) has the molecular formula C23H18N4O2S2 and a molecular weight of 446.56 g/mol. Its IUPAC name is (2E,5Z)-3-ethyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-ethyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845370 |
| Molecular Formula | C23H18N4O2S2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (2E,5Z)-3-ethyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2/C(=O)N(C)c3ccccc32)S/C1=N/c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H18N4O2S2/c1-3-27-21(29)19(18-15-11-7-8-12-17(15)26(2)20(18)28)31-23(27)25-22-24-16(13-30-22)14-9-5-4-6-10-14/h4-13H,3H2,1-2H3/b19-18-,25-23+ |
| InChIKey | SIPGRPSJFVCIAP-JIPMDXOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|