C20H15ClN4O2S — CID 18843433
(5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-(1-methyl-2-oxoindol-3-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18843433) has the molecular formula C20H15ClN4O2S and a molecular weight of 410.89 g/mol. Its IUPAC name is (5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-(1-methyl-2-oxoindol-3-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-(1-methyl-2-oxoindol-3-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843433 |
| Molecular Formula | C20H15ClN4O2S |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-(1-methyl-2-oxoindol-3-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2/C(=O)N(C)c3ccccc32)S/C1=N\c1cccnc1Cl |
| InChI | InChI=1S/C20H15ClN4O2S/c1-3-11-25-19(27)16(28-20(25)23-13-8-6-10-22-17(13)21)15-12-7-4-5-9-14(12)24(2)18(15)26/h3-10H,1,11H2,2H3/b16-15-,23-20- |
| InChIKey | KKZALOUWJWRKSH-KPZWNYGJSA-N |
| XLogP | 3.87 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|