C17H13ClFN3OS — CID 18843315
(5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18843315) has the molecular formula C17H13ClFN3OS and a molecular weight of 361.83 g/mol. Its IUPAC name is (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843315 |
| Molecular Formula | C17H13ClFN3OS |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(F)cc2)S/C1=N/c1cccnc1Cl |
| InChI | InChI=1S/C17H13ClFN3OS/c1-2-22-16(23)14(10-11-5-7-12(19)8-6-11)24-17(22)21-13-4-3-9-20-15(13)18/h3-10H,2H2,1H3/b14-10-,21-17+ |
| InChIKey | YGLHAGSWIMOQIH-JIXLSXQHSA-N |
| XLogP | 4.50 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|