C25H21Cl2N3O3S — CID 18843286
(5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 18843286) has the molecular formula C25H21Cl2N3O3S and a molecular weight of 514.43 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843286 |
| Molecular Formula | C25H21Cl2N3O3S |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | (5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OCc3ccccc3Cl)c(OC)c2)S/C1=N/c1cccnc1Cl |
| InChI | InChI=1S/C25H21Cl2N3O3S/c1-3-30-24(31)22(34-25(30)29-19-9-6-12-28-23(19)27)14-16-10-11-20(21(13-16)32-2)33-15-17-7-4-5-8-18(17)26/h4-14H,3,15H2,1-2H3/b22-14-,29-25+ |
| InChIKey | DQQKXDIJURSGNR-LSLGUAFQSA-N |
| XLogP | 6.60 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|