C26H24ClN3O3S — CID 18842771
(2E,5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one (PubChem CID 18842771) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is (2E,5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842771 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (2E,5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OCc3ccccc3Cl)c(OC)c2)S/C1=N/c1cccc(C)n1 |
| InChI | InChI=1S/C26H24ClN3O3S/c1-4-30-25(31)23(34-26(30)29-24-11-7-8-17(2)28-24)15-18-12-13-21(22(14-18)32-3)33-16-19-9-5-6-10-20(19)27/h5-15H,4,16H2,1-3H3/b23-15-,29-26+ |
| InChIKey | BOIKNIVGRHQQNA-SJHJFPLISA-N |
| XLogP | 6.25 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|