C14H12FN5OS — CID 92904098
(2Z,5E)-3-ethyl-5-[(4-fluorophenyl)methylidene]-2-(1,2,4-triazol-4-ylimino)-1,3-thiazolidin-4-one (PubChem CID 92904098) has the molecular formula C14H12FN5OS and a molecular weight of 317.35 g/mol. Its IUPAC name is (2Z,5E)-3-ethyl-5-[(4-fluorophenyl)methylidene]-2-(1,2,4-triazol-4-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5E)-3-ethyl-5-[(4-fluorophenyl)methylidene]-2-(1,2,4-triazol-4-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 92904098 |
| Molecular Formula | C14H12FN5OS |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2Z,5E)-3-ethyl-5-[(4-fluorophenyl)methylidene]-2-(1,2,4-triazol-4-ylimino)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(F)cc2)S/C1=N\n1cnnc1 |
| InChI | InChI=1S/C14H12FN5OS/c1-2-20-13(21)12(7-10-3-5-11(15)6-4-10)22-14(20)18-19-8-16-17-9-19/h3-9H,2H2,1H3/b12-7+,18-14- |
| InChIKey | XMVJLACMAQTAHB-ACGFKXLJSA-N |
| XLogP | 2.17 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|