C21H18N4O4S — CID 18842817
2-[(3Z)-3-[(2E)-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetic acid (PubChem CID 18842817) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[(3Z)-3-[(2E)-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-3-[(2E)-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 18842817 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[(3Z)-3-[(2E)-3-ethyl-2-[(6-methyl-2-pyridinyl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetic acid |
| SMILES | CCN1C(=O)/C(=C2/C(=O)N(CC(=O)O)c3ccccc32)S/C1=N/c1cccc(C)n1 |
| InChI | InChI=1S/C21H18N4O4S/c1-3-24-20(29)18(30-21(24)23-15-10-6-7-12(2)22-15)17-13-8-4-5-9-14(13)25(19(17)28)11-16(26)27/h4-10H,3,11H2,1-2H3,(H,26,27)/b18-17-,23-21+ |
| InChIKey | DOUOMLDMIAKYLZ-CEEBWYBOSA-N |
| XLogP | 2.82 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|