C29H25N3O4S — CID 126395595
ethyl 2-[(3E)-3-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetate (PubChem CID 126395595) has the molecular formula C29H25N3O4S and a molecular weight of 511.60 g/mol. Its IUPAC name is ethyl 2-[(3E)-3-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetate.
| Compound Name | ethyl 2-[(3E)-3-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 126395595 |
| Molecular Formula | C29H25N3O4S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | ethyl 2-[(3E)-3-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)/C(=C2/S/C(=N\Cc3ccccc3)N(Cc3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C29H25N3O4S/c1-2-36-24(33)19-31-23-16-10-9-15-22(23)25(27(31)34)26-28(35)32(18-21-13-7-4-8-14-21)29(37-26)30-17-20-11-5-3-6-12-20/h3-16H,2,17-19H2,1H3/b26-25+,30-29- |
| InChIKey | XPORPOLSSMFFQM-AUMNFMOHSA-N |
| XLogP | 4.64 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|