C21H16N4O5S2 — CID 19169480
ethyl 2-[(3Z)-2-oxo-3-[4-oxo-3-(pyridine-4-carbonylamino)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetate (PubChem CID 19169480) has the molecular formula C21H16N4O5S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is ethyl 2-[(3Z)-2-oxo-3-[4-oxo-3-(pyridine-4-carbonylamino)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetate.
| Compound Name | ethyl 2-[(3Z)-2-oxo-3-[4-oxo-3-(pyridine-4-carbonylamino)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetate |
|---|---|
| PubChem CID | 19169480 |
| Molecular Formula | C21H16N4O5S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | ethyl 2-[(3Z)-2-oxo-3-[4-oxo-3-(pyridine-4-carbonylamino)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)/C(=C2\SC(=S)N(NC(=O)c3ccncc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C21H16N4O5S2/c1-2-30-15(26)11-24-14-6-4-3-5-13(14)16(19(24)28)17-20(29)25(21(31)32-17)23-18(27)12-7-9-22-10-8-12/h3-10H,2,11H2,1H3,(H,23,27)/b17-16- |
| InChIKey | KMHMXBISXNVNFG-MSUUIHNZSA-N |
| XLogP | 1.91 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|