C26H18ClN3O3S2 — CID 23905607
2-chloro-N-[5-[1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 23905607) has the molecular formula C26H18ClN3O3S2 and a molecular weight of 520.04 g/mol. Its IUPAC name is 2-chloro-N-[5-[1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23905607 |
| Molecular Formula | C26H18ClN3O3S2 |
| Molecular Weight | 520.04 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 2-chloro-N-[5-[1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1ccc(CN2C(=O)C(=C3SC(=S)N(NC(=O)c4ccccc4Cl)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H18ClN3O3S2/c1-15-10-12-16(13-11-15)14-29-20-9-5-3-7-18(20)21(24(29)32)22-25(33)30(26(34)35-22)28-23(31)17-6-2-4-8-19(17)27/h2-13H,14H2,1H3,(H,28,31) |
| InChIKey | XQNNWYRWSFAGTP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.04 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|