C19H11Cl2N3O3S2 — CID 23993261
2,3-dichloro-N-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 23993261) has the molecular formula C19H11Cl2N3O3S2 and a molecular weight of 464.36 g/mol. Its IUPAC name is 2,3-dichloro-N-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23993261 |
| Molecular Formula | C19H11Cl2N3O3S2 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 2,3-dichloro-N-[5-(1-methyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | CN1C(=O)C(=C2SC(=S)N(NC(=O)c3cccc(Cl)c3Cl)C2=O)c2ccccc21 |
| InChI | InChI=1S/C19H11Cl2N3O3S2/c1-23-12-8-3-2-5-9(12)13(17(23)26)15-18(27)24(19(28)29-15)22-16(25)10-6-4-7-11(20)14(10)21/h2-8H,1H3,(H,22,25) |
| InChIKey | WESKMFBCENGYCI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|