C24H15ClN4O3S2 — CID 1385855
N-[5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide (PubChem CID 1385855) has the molecular formula C24H15ClN4O3S2 and a molecular weight of 507.00 g/mol. Its IUPAC name is N-[5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 1385855 |
| Molecular Formula | C24H15ClN4O3S2 |
| Molecular Weight | 507.00 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | N-[5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(NN1C(=O)C(=C2C(=O)N(Cc3ccccc3Cl)c3ccccc32)SC1=S)c1ccncc1 |
| InChI | InChI=1S/C24H15ClN4O3S2/c25-17-7-3-1-5-15(17)13-28-18-8-4-2-6-16(18)19(22(28)31)20-23(32)29(24(33)34-20)27-21(30)14-9-11-26-12-10-14/h1-12H,13H2,(H,27,30) |
| InChIKey | JRRYHMCRVYCGJO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.00 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|