C25H23ClN2O4S2 — CID 19195872
methyl 6-[(5Z)-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 19195872) has the molecular formula C25H23ClN2O4S2 and a molecular weight of 515.06 g/mol. Its IUPAC name is methyl 6-[(5Z)-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | methyl 6-[(5Z)-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 19195872 |
| Molecular Formula | C25H23ClN2O4S2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | methyl 6-[(5Z)-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | COC(=O)CCCCCN1C(=O)/C(=C2/C(=O)N(Cc3ccccc3Cl)c3ccccc32)SC1=S |
| InChI | InChI=1S/C25H23ClN2O4S2/c1-32-20(29)13-3-2-8-14-27-24(31)22(34-25(27)33)21-17-10-5-7-12-19(17)28(23(21)30)15-16-9-4-6-11-18(16)26/h4-7,9-12H,2-3,8,13-15H2,1H3/b22-21- |
| InChIKey | LFXFFSVWVJRHFP-DQRAZIAOSA-N |
| XLogP | 5.19 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|