C32H24ClN3O2S — CID 126390649
(5E)-3-benzyl-2-benzylimino-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-1,3-thiazolidin-4-one (PubChem CID 126390649) has the molecular formula C32H24ClN3O2S and a molecular weight of 550.08 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126390649 |
| Molecular Formula | C32H24ClN3O2S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C2\C(=O)N(Cc3ccccc3Cl)c3ccccc32)S/C(=N\Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C32H24ClN3O2S/c33-26-17-9-7-15-24(26)21-35-27-18-10-8-16-25(27)28(30(35)37)29-31(38)36(20-23-13-5-2-6-14-23)32(39-29)34-19-22-11-3-1-4-12-22/h1-18H,19-21H2/b29-28+,34-32- |
| InChIKey | CSNSCGDDSPRDLT-ZICOJBMRSA-N |
| XLogP | 6.93 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|