C18H12Cl3N3OS — CID 18843422
(5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-[(2,4-dichlorophenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18843422) has the molecular formula C18H12Cl3N3OS and a molecular weight of 424.74 g/mol. Its IUPAC name is (5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-[(2,4-dichlorophenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-[(2,4-dichlorophenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843422 |
| Molecular Formula | C18H12Cl3N3OS |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-5-[(2,4-dichlorophenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(Cl)cc2Cl)S/C1=N/c1cccnc1Cl |
| InChI | InChI=1S/C18H12Cl3N3OS/c1-2-8-24-17(25)15(9-11-5-6-12(19)10-13(11)20)26-18(24)23-14-4-3-7-22-16(14)21/h2-7,9-10H,1,8H2/b15-9-,23-18+ |
| InChIKey | TXMQMNXRXSDZSF-HMLQPPTQSA-N |
| XLogP | 5.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|