C23H17ClN4O4S — CID 18843402
(5E)-2-[(2-chloro-3-pyridinyl)imino]-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18843402) has the molecular formula C23H17ClN4O4S and a molecular weight of 480.93 g/mol. Its IUPAC name is (5E)-2-[(2-chloro-3-pyridinyl)imino]-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[(2-chloro-3-pyridinyl)imino]-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843402 |
| Molecular Formula | C23H17ClN4O4S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (5E)-2-[(2-chloro-3-pyridinyl)imino]-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(-c3ccc(C)cc3[N+](=O)[O-])o2)S/C1=N\c1cccnc1Cl |
| InChI | InChI=1S/C23H17ClN4O4S/c1-3-11-27-22(29)20(33-23(27)26-17-5-4-10-25-21(17)24)13-15-7-9-19(32-15)16-8-6-14(2)12-18(16)28(30)31/h3-10,12-13H,1,11H2,2H3/b20-13+,26-23- |
| InChIKey | OOTGFXTWMMWRPC-VOYPSTMSSA-N |
| XLogP | 6.00 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|