C23H27N3O4S — CID 4515527
3-butyl-2-butylimino-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 4515527) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-butyl-2-butylimino-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-butyl-2-butylimino-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4515527 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-butyl-2-butylimino-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCC/N=C1\SC(=Cc2ccc(-c3ccc(C)cc3[N+](=O)[O-])o2)C(=O)N1CCCC |
| InChI | InChI=1S/C23H27N3O4S/c1-4-6-12-24-23-25(13-7-5-2)22(27)21(31-23)15-17-9-11-20(30-17)18-10-8-16(3)14-19(18)26(28)29/h8-11,14-15H,4-7,12-13H2,1-3H3/b21-15?,24-23- |
| InChIKey | WYNTXVSRDXPBNC-RUDNBLMXSA-N |
| XLogP | 6.04 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|