C20H14Cl2N2O4S — CID 27429662
2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid (PubChem CID 27429662) has the molecular formula C20H14Cl2N2O4S and a molecular weight of 449.32 g/mol. Its IUPAC name is 2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 27429662 |
| Molecular Formula | C20H14Cl2N2O4S |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(Cl)cc2Cl)S/C1=N/c1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C20H14Cl2N2O4S/c1-2-7-24-18(26)17(8-11-3-4-12(21)9-15(11)22)29-20(24)23-16-6-5-13(25)10-14(16)19(27)28/h2-6,8-10,25H,1,7H2,(H,27,28)/b17-8-,23-20+ |
| InChIKey | BFOYLUVLRWXRTR-DVELPCAWSA-N |
| XLogP | 5.19 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|