C22H20N2O6S — CID 27429607
2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid (PubChem CID 27429607) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 27429607 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(OC)cc2OC)S/C1=N/c1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C22H20N2O6S/c1-4-9-24-20(26)19(10-13-5-7-15(29-2)12-18(13)30-3)31-22(24)23-17-8-6-14(25)11-16(17)21(27)28/h4-8,10-12,25H,1,9H2,2-3H3,(H,27,28)/b19-10-,23-22+ |
| InChIKey | XPYMHWBBCIBKJB-AICPIJHFSA-N |
| XLogP | 3.90 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|