C23H18N2O5S — CID 27429728
2-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid (PubChem CID 27429728) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is 2-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 27429728 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[[(5Z)-5-(2H-chromen-3-ylmethylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
| SMILES | C=CCN1C(=O)/C(=C/C2=Cc3ccccc3OC2)S/C1=N/c1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C23H18N2O5S/c1-2-9-25-21(27)20(11-14-10-15-5-3-4-6-19(15)30-13-14)31-23(25)24-18-8-7-16(26)12-17(18)22(28)29/h2-8,10-12,26H,1,9,13H2,(H,28,29)/b20-11-,24-23+ |
| InChIKey | BGPRQISWMHNXCV-JISVWFQASA-N |
| XLogP | 4.20 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|