C15H15NO4S — CID 53447609
5-[(2,4-dimethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 53447609) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2,4-dimethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 53447609 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)SC(=Cc2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C15H15NO4S/c1-4-7-16-14(17)13(21-15(16)18)8-10-5-6-11(19-2)9-12(10)20-3/h4-6,8-9H,1,7H2,2-3H3 |
| InChIKey | FUQDKIZDLDWAKD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|