C24H20N2O6S2 — CID 2318333
(5Z)-5-benzylidene-3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2318333) has the molecular formula C24H20N2O6S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-benzylidene-3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2318333 |
| Molecular Formula | C24H20N2O6S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | (5Z)-5-benzylidene-3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCN3C(=O)S/C(=C\c4ccccc4)C3=O)C2=O)c(OC)c1 |
| InChI | InChI=1S/C24H20N2O6S2/c1-31-17-9-8-16(18(14-17)32-2)13-20-22(28)26(24(30)34-20)11-10-25-21(27)19(33-23(25)29)12-15-6-4-3-5-7-15/h3-9,12-14H,10-11H2,1-2H3/b19-12-,20-13- |
| InChIKey | XMVVDKQWVLAXKP-YXZJEIOKSA-N |
| XLogP | 4.48 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|