C26H23N3O7S2 — CID 6529712
N-[4-[(Z)-[3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide (PubChem CID 6529712) has the molecular formula C26H23N3O7S2 and a molecular weight of 553.62 g/mol. Its IUPAC name is N-[4-[(Z)-[3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 6529712 |
| Molecular Formula | C26H23N3O7S2 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | N-[4-[(Z)-[3-[2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCN3C(=O)S/C(=C\c4ccc(NC(C)=O)cc4)C3=O)C2=O)c(OC)c1 |
| InChI | InChI=1S/C26H23N3O7S2/c1-15(30)27-18-7-4-16(5-8-18)12-21-23(31)28(25(33)37-21)10-11-29-24(32)22(38-26(29)34)13-17-6-9-19(35-2)14-20(17)36-3/h4-9,12-14H,10-11H2,1-3H3,(H,27,30)/b21-12-,22-13- |
| InChIKey | PHPMVMANQBIKES-HDSGJDLKSA-N |
| XLogP | 4.43 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|