C17H21N2O5S+ — CID 6991650
(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(morpholin-4-ium-4-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 6991650) has the molecular formula C17H21N2O5S+ and a molecular weight of 365.43 g/mol. Its IUPAC name is (5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(morpholin-4-ium-4-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(morpholin-4-ium-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6991650 |
| Molecular Formula | C17H21N2O5S+ |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(morpholin-4-ium-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2\SC(=O)N(C[NH+]3CCOCC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-22-13-4-3-12(14(10-13)23-2)9-15-16(20)19(17(21)25-15)11-18-5-7-24-8-6-18/h3-4,9-10H,5-8,11H2,1-2H3/p+1/b15-9- |
| InChIKey | GLGYHHQAKIXJLX-DHDCSXOGSA-O |
| XLogP | 0.61 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|