C17H13Cl2N3OS — CID 18841878
(2E,5Z)-5-[(2,4-dichlorophenyl)methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 18841878) has the molecular formula C17H13Cl2N3OS and a molecular weight of 378.28 g/mol. Its IUPAC name is (2E,5Z)-5-[(2,4-dichlorophenyl)methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2,4-dichlorophenyl)methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18841878 |
| Molecular Formula | C17H13Cl2N3OS |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (2E,5Z)-5-[(2,4-dichlorophenyl)methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(Cl)cc2Cl)S/C1=N/c1ccccn1 |
| InChI | InChI=1S/C17H13Cl2N3OS/c1-2-22-16(23)14(9-11-6-7-12(18)10-13(11)19)24-17(22)21-15-5-3-4-8-20-15/h3-10H,2H2,1H3/b14-9-,21-17+ |
| InChIKey | OHFZMOAAWQPIAC-NLNXUYBSSA-N |
| XLogP | 5.01 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|