C21H17N3OS — CID 18841902
(2E,5Z)-3-ethyl-5-(naphthalen-1-ylmethylidene)-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 18841902) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is (2E,5Z)-3-ethyl-5-(naphthalen-1-ylmethylidene)-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-ethyl-5-(naphthalen-1-ylmethylidene)-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18841902 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (2E,5Z)-3-ethyl-5-(naphthalen-1-ylmethylidene)-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cccc3ccccc23)S/C1=N/c1ccccn1 |
| InChI | InChI=1S/C21H17N3OS/c1-2-24-20(25)18(26-21(24)23-19-12-5-6-13-22-19)14-16-10-7-9-15-8-3-4-11-17(15)16/h3-14H,2H2,1H3/b18-14-,23-21+ |
| InChIKey | WARBVRMXYRULAG-VUXKIEERSA-N |
| XLogP | 4.86 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|