C24H20ClN3O2S — CID 18841839
(2E,5Z)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 18841839) has the molecular formula C24H20ClN3O2S and a molecular weight of 449.96 g/mol. Its IUPAC name is (2E,5Z)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18841839 |
| Molecular Formula | C24H20ClN3O2S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (2E,5Z)-5-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccccc2OCc2ccc(Cl)cc2)S/C1=N/c1ccccn1 |
| InChI | InChI=1S/C24H20ClN3O2S/c1-2-28-23(29)21(31-24(28)27-22-9-5-6-14-26-22)15-18-7-3-4-8-20(18)30-16-17-10-12-19(25)13-11-17/h3-15H,2,16H2,1H3/b21-15-,27-24+ |
| InChIKey | YRZPMMBULSBERG-AGEIGWASSA-N |
| XLogP | 5.94 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|