C25H22ClN3O3S — CID 18841745
(2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 18841745) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is (2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18841745 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | (2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-methyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccccn3)N(C)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClN3O3S/c1-3-31-21-14-18(9-12-20(21)32-16-17-7-10-19(26)11-8-17)15-22-24(30)29(2)25(33-22)28-23-6-4-5-13-27-23/h4-15H,3,16H2,1-2H3/b22-15-,28-25+ |
| InChIKey | LNKULRVCFHFIET-JFEQFACDSA-N |
| XLogP | 5.95 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|