C20H18Cl2N2OS — CID 8990753
(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(2-methylpropyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 8990753) has the molecular formula C20H18Cl2N2OS and a molecular weight of 405.35 g/mol. Its IUPAC name is (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(2-methylpropyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(2-methylpropyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 8990753 |
| Molecular Formula | C20H18Cl2N2OS |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(2-methylpropyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CC(C)CN1C(=O)/C(=C\c2ccc(Cl)cc2Cl)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H18Cl2N2OS/c1-13(2)12-24-19(25)18(10-14-8-9-15(21)11-17(14)22)26-20(24)23-16-6-4-3-5-7-16/h3-11,13H,12H2,1-2H3/b18-10+,23-20- |
| InChIKey | GDGMLBUBXMQDGA-HPGAWOKTSA-N |
| XLogP | 6.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|