C27H18Cl2N2O2S — CID 4704697
5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-2-naphthalen-1-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 4704697) has the molecular formula C27H18Cl2N2O2S and a molecular weight of 505.43 g/mol. Its IUPAC name is 5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-2-naphthalen-1-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-2-naphthalen-1-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4704697 |
| Molecular Formula | C27H18Cl2N2O2S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-2-naphthalen-1-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(-c3cc(Cl)cc(Cl)c3)o2)S/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C27H18Cl2N2O2S/c1-2-12-31-26(32)25(16-21-10-11-24(33-21)18-13-19(28)15-20(29)14-18)34-27(31)30-23-9-5-7-17-6-3-4-8-22(17)23/h2-11,13-16H,1,12H2/b25-16?,30-27- |
| InChIKey | QVHFOIITHBOVCV-LOCIQUTJSA-N |
| XLogP | 8.20 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|