C23H17ClFN3O5S — CID 5077481
N-[4-[5-[[1-(3-chloro-4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide (PubChem CID 5077481) has the molecular formula C23H17ClFN3O5S and a molecular weight of 501.92 g/mol. Its IUPAC name is N-[4-[5-[[1-(3-chloro-4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[5-[[1-(3-chloro-4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 5077481 |
| Molecular Formula | C23H17ClFN3O5S |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | N-[4-[5-[[1-(3-chloro-4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(-c2ccc(C=C3C(=O)N(c4ccc(F)c(Cl)c4)N=C3C)o2)cc1 |
| InChI | InChI=1S/C23H17ClFN3O5S/c1-13-19(23(30)28(26-13)16-5-9-21(25)20(24)11-16)12-17-6-10-22(33-17)15-3-7-18(8-4-15)34(31,32)27-14(2)29/h3-12H,1-2H3,(H,27,29) |
| InChIKey | BIGHWRGDSCIPPB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|