C22H14N2O3 — CID 7320602
(5Z)-4-methyl-5-[(5-naphthalen-1-ylfuran-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 7320602) has the molecular formula C22H14N2O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is (5Z)-4-methyl-5-[(5-naphthalen-1-ylfuran-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-4-methyl-5-[(5-naphthalen-1-ylfuran-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 7320602 |
| Molecular Formula | C22H14N2O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (5Z)-4-methyl-5-[(5-naphthalen-1-ylfuran-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)NC(=O)/C1=C\c1ccc(-c2cccc3ccccc23)o1 |
| InChI | InChI=1S/C22H14N2O3/c1-13-18(21(25)24-22(26)19(13)12-23)11-15-9-10-20(27-15)17-8-4-6-14-5-2-3-7-16(14)17/h2-11H,1H3,(H,24,25,26)/b18-11- |
| InChIKey | YMKOUVGSDDXZKL-WQRHYEAKSA-N |
| XLogP | 3.98 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|