C19H11F3N2O3 — CID 3952279
4-methyl-2,6-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 3952279) has the molecular formula C19H11F3N2O3 and a molecular weight of 372.30 g/mol. Its IUPAC name is 4-methyl-2,6-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | 4-methyl-2,6-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3952279 |
| Molecular Formula | C19H11F3N2O3 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 4-methyl-2,6-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)NC(=O)C1=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C19H11F3N2O3/c1-10-14(17(25)24-18(26)15(10)9-23)8-13-5-6-16(27-13)11-3-2-4-12(7-11)19(20,21)22/h2-8H,1H3,(H,24,25,26) |
| InChIKey | PLXZFVJUICPAQE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|