C22H19F3N2O4 — CID 3951834
1-cyclohexyl-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3951834) has the molecular formula C22H19F3N2O4 and a molecular weight of 432.40 g/mol. Its IUPAC name is 1-cyclohexyl-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-cyclohexyl-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3951834 |
| Molecular Formula | C22H19F3N2O4 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 1-cyclohexyl-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCCC2)C(=O)C1=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C22H19F3N2O4/c23-22(24,25)14-6-4-5-13(11-14)18-10-9-16(31-18)12-17-19(28)26-21(30)27(20(17)29)15-7-2-1-3-8-15/h4-6,9-12,15H,1-3,7-8H2,(H,26,28,30) |
| InChIKey | HREUARILBVGIQL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|