C20H12F3NO2 — CID 124672233
(3Z)-3-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one (PubChem CID 124672233) has the molecular formula C20H12F3NO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is (3Z)-3-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 124672233 |
| Molecular Formula | C20H12F3NO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (3Z)-3-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H12F3NO2/c21-20(22,23)13-5-3-4-12(10-13)18-9-8-14(26-18)11-16-15-6-1-2-7-17(15)24-19(16)25/h1-11H,(H,24,25)/b16-11- |
| InChIKey | ZJEVTXDTOFZNDI-WJDWOHSUSA-N |
| XLogP | 5.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|