C28H26F3N3O3 — CID 59190311
N-[(1-methylpiperidin-2-yl)methyl]-3-[5-[(E)-[2-oxo-5-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzamide (PubChem CID 59190311) has the molecular formula C28H26F3N3O3 and a molecular weight of 509.53 g/mol. Its IUPAC name is N-[(1-methylpiperidin-2-yl)methyl]-3-[5-[(E)-[2-oxo-5-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzamide.
| Compound Name | N-[(1-methylpiperidin-2-yl)methyl]-3-[5-[(E)-[2-oxo-5-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 59190311 |
| Molecular Formula | C28H26F3N3O3 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-[(1-methylpiperidin-2-yl)methyl]-3-[5-[(E)-[2-oxo-5-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzamide |
| SMILES | CN1CCCCC1CNC(=O)c1cccc(-c2ccc(/C=C3/C(=O)Nc4ccc(C(F)(F)F)cc43)o2)c1 |
| InChI | InChI=1S/C28H26F3N3O3/c1-34-12-3-2-7-20(34)16-32-26(35)18-6-4-5-17(13-18)25-11-9-21(37-25)15-23-22-14-19(28(29,30)31)8-10-24(22)33-27(23)36/h4-6,8-11,13-15,20H,2-3,7,12,16H2,1H3,(H,32,35)(H,33,36)/b23-15+ |
| InChIKey | WDLJMNSLPZWADV-HZHRSRAPSA-N |
| XLogP | 5.67 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|