C25H19FN4O3 — CID 59190145
3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(3-methylimidazol-4-yl)methyl]benzamide (PubChem CID 59190145) has the molecular formula C25H19FN4O3 and a molecular weight of 442.45 g/mol. Its IUPAC name is 3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(3-methylimidazol-4-yl)methyl]benzamide.
| Compound Name | 3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(3-methylimidazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 59190145 |
| Molecular Formula | C25H19FN4O3 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(3-methylimidazol-4-yl)methyl]benzamide |
| SMILES | Cn1cncc1CNC(=O)c1cccc(-c2ccc(/C=C3/C(=O)Nc4ccc(F)cc43)o2)c1 |
| InChI | InChI=1S/C25H19FN4O3/c1-30-14-27-12-18(30)13-28-24(31)16-4-2-3-15(9-16)23-8-6-19(33-23)11-21-20-10-17(26)5-7-22(20)29-25(21)32/h2-12,14H,13H2,1H3,(H,28,31)(H,29,32)/b21-11+ |
| InChIKey | CSIFVVAISBKGFU-SRZZPIQSSA-N |
| XLogP | 4.24 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|