C27H26ClN3O4 — CID 72539080
3-[5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 72539080) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 3-[5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 3-[5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 72539080 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | O=C1Nc2ccc(Cl)cc2C1=Cc1ccc(-c2cccc(C(=O)NCCCN3CCOCC3)c2)o1 |
| InChI | InChI=1S/C27H26ClN3O4/c28-20-5-7-24-22(16-20)23(27(33)30-24)17-21-6-8-25(35-21)18-3-1-4-19(15-18)26(32)29-9-2-10-31-11-13-34-14-12-31/h1,3-8,15-17H,2,9-14H2,(H,29,32)(H,30,33) |
| InChIKey | XNPDCPZOARTUSG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|