C29H30ClN3O3 — CID 59190107
3-[5-[(E)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 59190107) has the molecular formula C29H30ClN3O3 and a molecular weight of 504.03 g/mol. Its IUPAC name is 3-[5-[(E)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 3-[5-[(E)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 59190107 |
| Molecular Formula | C29H30ClN3O3 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 3-[5-[(E)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | CC1CCN(CCCNC(=O)c2cccc(-c3ccc(/C=C4/C(=O)Nc5ccc(Cl)cc54)o3)c2)CC1 |
| InChI | InChI=1S/C29H30ClN3O3/c1-19-10-14-33(15-11-19)13-3-12-31-28(34)21-5-2-4-20(16-21)27-9-7-23(36-27)18-25-24-17-22(30)6-8-26(24)32-29(25)35/h2,4-9,16-19H,3,10-15H2,1H3,(H,31,34)(H,32,35)/b25-18+ |
| InChIKey | KVKACPLVCWQOLH-XIEYBQDHSA-N |
| XLogP | 5.94 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|