C27H26FN3O3 — CID 72538984
4-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(1-methylpiperidin-2-yl)methyl]benzamide (PubChem CID 72538984) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is 4-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(1-methylpiperidin-2-yl)methyl]benzamide.
| Compound Name | 4-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(1-methylpiperidin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 72538984 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]-N-[(1-methylpiperidin-2-yl)methyl]benzamide |
| SMILES | CN1CCCCC1CNC(=O)c1ccc(-c2ccc(C=C3C(=O)Nc4ccc(F)cc43)o2)cc1 |
| InChI | InChI=1S/C27H26FN3O3/c1-31-13-3-2-4-20(31)16-29-26(32)18-7-5-17(6-8-18)25-12-10-21(34-25)15-23-22-14-19(28)9-11-24(22)30-27(23)33/h5-12,14-15,20H,2-4,13,16H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | PERFVIDPOVZXNC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|