C27H25ClFN3O3 — CID 59190154
4-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide (PubChem CID 59190154) has the molecular formula C27H25ClFN3O3 and a molecular weight of 493.97 g/mol. Its IUPAC name is 4-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 59190154 |
| Molecular Formula | C27H25ClFN3O3 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 4-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-[5-[(E)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide |
| SMILES | CCN1CCCC1CNC(=O)c1ccc(Cl)c(-c2ccc(/C=C3/C(=O)Nc4ccc(F)cc43)o2)c1 |
| InChI | InChI=1S/C27H25ClFN3O3/c1-2-32-11-3-4-18(32)15-30-26(33)16-5-8-23(28)22(12-16)25-10-7-19(35-25)14-21-20-13-17(29)6-9-24(20)31-27(21)34/h5-10,12-14,18H,2-4,11,15H2,1H3,(H,30,33)(H,31,34)/b21-14+ |
| InChIKey | FXLJVPFNSBQKPX-KGENOOAVSA-N |
| XLogP | 5.45 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|