C21H14FNO4 — CID 72539022
methyl 2-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 72539022) has the molecular formula C21H14FNO4 and a molecular weight of 363.34 g/mol. Its IUPAC name is methyl 2-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 72539022 |
| Molecular Formula | C21H14FNO4 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | methyl 2-[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(C=C2C(=O)Nc3ccc(F)cc32)o1 |
| InChI | InChI=1S/C21H14FNO4/c1-26-21(25)15-5-3-2-4-14(15)19-9-7-13(27-19)11-17-16-10-12(22)6-8-18(16)23-20(17)24/h2-11H,1H3,(H,23,24) |
| InChIKey | IQHUHHKKKSIQDX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|