C23H16F3NO4 — CID 21374061
ethyl 4-[5-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 21374061) has the molecular formula C23H16F3NO4 and a molecular weight of 427.38 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 21374061 |
| Molecular Formula | C23H16F3NO4 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | ethyl 4-[5-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3/C(=O)Nc4cc(C(F)(F)F)ccc43)o2)cc1 |
| InChI | InChI=1S/C23H16F3NO4/c1-2-30-22(29)14-5-3-13(4-6-14)20-10-8-16(31-20)12-18-17-9-7-15(23(24,25)26)11-19(17)27-21(18)28/h3-12H,2H2,1H3,(H,27,28)/b18-12+ |
| InChIKey | OBJPJJARFXRZTG-LDADJPATSA-N |
| XLogP | 5.63 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|